* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035576 |
English Synonyms: | SYNTHON-LAB SL035576 |
MDL Number.: | MFCD03834803 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1)NC(=O)/C(=C/c2cn(c3c2cccc3)CC(=O)Nc4ccc(cc4)Cl)/C#N |
InChi: | InChI=1S/C27H21ClN4O2/c1-18-6-10-23(11-7-18)31-27(34)19(15-29)14-20-16-32(25-5-3-2-4-24(20)25)17-26(33)30-22-12-8-21(28)9-13-22/h2-14,16H,17H2,1H3,(H,30,33)(H,31,34)/b19-14+ |
InChiKey: | InChIKey=DYWUOEZGPCXGBX-XMHGGMMESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.