* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034250 |
English Synonyms: | SYNTHON-LAB SL034250 |
MDL Number.: | MFCD03834807 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)c(cn2CC(=O)Nc3ccc(cc3)F)/C=C(\C#N)/C(=O)Nc4cccc(c4Cl)Cl |
InChi: | InChI=1S/C26H17Cl2FN4O2/c27-21-5-3-6-22(25(21)28)32-26(35)16(13-30)12-17-14-33(23-7-2-1-4-20(17)23)15-24(34)31-19-10-8-18(29)9-11-19/h1-12,14H,15H2,(H,31,34)(H,32,35)/b16-12+ |
InChiKey: | InChIKey=XUYBTIWOPKUKSO-FOWTUZBSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.