* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033917 |
English Synonyms: | SYNTHON-LAB SL033917 |
MDL Number.: | MFCD03834838 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COc1cccc(c1OCC(=O)Nc2ccccc2)/C=C/3\C(=O)N/C(=N/c4cccc(c4Cl)Cl)/S3 |
InChi: | InChI=1S/C25H19Cl2N3O4S/c1-33-19-12-5-7-15(23(19)34-14-21(31)28-16-8-3-2-4-9-16)13-20-24(32)30-25(35-20)29-18-11-6-10-17(26)22(18)27/h2-13H,14H2,1H3,(H,28,31)(H,29,30,32)/b20-13+ |
InChiKey: | InChIKey=NXCQMUQIBLSZDN-DEDYPNTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.