* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL026971 |
English Synonyms: | SYNTHON-LAB SL026971 |
MDL Number.: | MFCD03834840 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)C(F)(F)F)C(=O)N/N=C\c2cc(c(o2)Br)Br |
InChi: | InChI=1S/C13H7Br2F3N2O2/c14-10-5-9(22-11(10)15)6-19-20-12(21)7-2-1-3-8(4-7)13(16,17)18/h1-6H,(H,20,21)/b19-6- |
InChiKey: | InChIKey=ISJROOLNJMXOSM-SWNXQHNESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.