* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL026975 |
| English Synonyms: | SYNTHON-LAB SL026975 |
| MDL Number.: | MFCD03834841 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | C/C(=C\c1ccccc1)/C=N\NC(=O)c2cccc(c2)C(F)(F)F |
| InChi: | InChI=1S/C18H15F3N2O/c1-13(10-14-6-3-2-4-7-14)12-22-23-17(24)15-8-5-9-16(11-15)18(19,20)21/h2-12H,1H3,(H,23,24)/b13-10+,22-12- |
| InChiKey: | InChIKey=MHVHHPNOMKMFBP-AZKFBJOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.