* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL026974 |
English Synonyms: | SYNTHON-LAB SL026974 |
MDL Number.: | MFCD03834842 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(c(c1)COc2c(cc(cc2Cl)/C=N\NC(=O)c3cccc(c3)C(F)(F)F)Cl)Cl |
InChi: | InChI=1S/C22H14Cl3F3N2O2/c23-17-7-2-1-4-15(17)12-32-20-18(24)8-13(9-19(20)25)11-29-30-21(31)14-5-3-6-16(10-14)22(26,27)28/h1-11H,12H2,(H,30,31)/b29-11- |
InChiKey: | InChIKey=NTUIQTYQRZRBGU-KYMQWJLESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.