* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034346 |
English Synonyms: | SYNTHON-LAB SL034346 |
MDL Number.: | MFCD03834858 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | CCOc1cc(cc(c1OCc2ccc(cc2)[N+](=O)[O-])CC=C)/C=C(\C#N)/C(=O)NCC3CCCO3 |
InChi: | InChI=1S/C27H29N3O6/c1-3-6-21-13-20(14-22(16-28)27(31)29-17-24-7-5-12-35-24)15-25(34-4-2)26(21)36-18-19-8-10-23(11-9-19)30(32)33/h3,8-11,13-15,24H,1,4-7,12,17-18H2,2H3,(H,29,31)/b22-14+ |
InChiKey: | InChIKey=VKHBRBWEMZWYMB-HYARGMPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.