* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034228 |
English Synonyms: | SYNTHON-LAB SL034228 |
MDL Number.: | MFCD03834865 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | Cc1cc(ccc1/C=C(\C#N)/C(=O)NCc2ccco2)N3CCCCC3 |
InChi: | InChI=1S/C21H23N3O2/c1-16-12-19(24-9-3-2-4-10-24)8-7-17(16)13-18(14-22)21(25)23-15-20-6-5-11-26-20/h5-8,11-13H,2-4,9-10,15H2,1H3,(H,23,25)/b18-13+ |
InChiKey: | InChIKey=PJXUZCLAFHJFHC-QGOAFFKASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.