* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035734 |
English Synonyms: | SYNTHON-LAB SL035734 |
MDL Number.: | MFCD03834867 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCC(C)Oc1c(cc(cc1Br)/C=C(\C#N)/C(=O)NCc2ccco2)OC |
InChi: | InChI=1S/C20H21BrN2O4/c1-4-13(2)27-19-17(21)9-14(10-18(19)25-3)8-15(11-22)20(24)23-12-16-6-5-7-26-16/h5-10,13H,4,12H2,1-3H3,(H,23,24)/b15-8+ |
InChiKey: | InChIKey=RZUDEVWEGFVTAM-OVCLIPMQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.