* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | SYNTHON-LAB SL035598 |
English Synonyms: | SYNTHON-LAB SL035598 |
MDL Number.: | MFCD03834868 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOc1cc(ccc1OCc2ccccc2F)/C=C(\C#N)/C(=O)Nc3cccc(c3)Cl |
InChi: | InChI=1S/C25H20ClFN2O3/c1-2-31-24-13-17(10-11-23(24)32-16-18-6-3-4-9-22(18)27)12-19(15-28)25(30)29-21-8-5-7-20(26)14-21/h3-14H,2,16H2,1H3,(H,29,30)/b19-12+ |
InChiKey: | InChIKey=PRRYERPZNPGUOS-XDHOZWIPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.