* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034374 |
English Synonyms: | SYNTHON-LAB SL034374 |
MDL Number.: | MFCD03834871 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCC(C)Oc1c(cccc1OC)/C=C(\C#N)/C(=O)Nc2cccc(c2)Cl |
InChi: | InChI=1S/C21H21ClN2O3/c1-4-14(2)27-20-15(7-5-10-19(20)26-3)11-16(13-23)21(25)24-18-9-6-8-17(22)12-18/h5-12,14H,4H2,1-3H3,(H,24,25)/b16-11+ |
InChiKey: | InChIKey=JSGKISAIIPSRKV-LFIBNONCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.