* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035250 |
English Synonyms: | SYNTHON-LAB SL035250 |
MDL Number.: | MFCD03834874 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1NC(=O)/C(=C/c2cn(c3c2cccc3)CC(=O)O)/C#N)Cl |
InChi: | InChI=1S/C21H16ClN3O3/c1-13-6-7-16(22)9-18(13)24-21(28)14(10-23)8-15-11-25(12-20(26)27)19-5-3-2-4-17(15)19/h2-9,11H,12H2,1H3,(H,24,28)(H,26,27)/b14-8+ |
InChiKey: | InChIKey=HQZJMAPBPQRLPO-RIYZIHGNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.