* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034333 |
| English Synonyms: | SYNTHON-LAB SL034333 |
| MDL Number.: | MFCD03834881 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1NC(=O)/C(=C/c2cccc(c2OC(C)C)OC)/C#N)Cl |
| InChi: | InChI=1S/C21H21ClN2O3/c1-13(2)27-20-15(6-5-7-19(20)26-4)10-16(12-23)21(25)24-18-11-17(22)9-8-14(18)3/h5-11,13H,1-4H3,(H,24,25)/b16-10+ |
| InChiKey: | InChIKey=RUKSNQGMZGQPSQ-MHWRWJLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.