* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034327 |
| English Synonyms: | SYNTHON-LAB SL034327 |
| MDL Number.: | MFCD03834882 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCC(C)n1cc(c2c1cccc2)/C=C(\C#N)/C(=O)Nc3cc(ccc3C)Cl |
| InChi: | InChI=1S/C23H22ClN3O/c1-4-16(3)27-14-18(20-7-5-6-8-22(20)27)11-17(13-25)23(28)26-21-12-19(24)10-9-15(21)2/h5-12,14,16H,4H2,1-3H3,(H,26,28)/b17-11+ |
| InChiKey: | InChIKey=KBKWGOKTKGXMIZ-GZTJUZNOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.