* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034384 |
English Synonyms: | SYNTHON-LAB SL034384 |
MDL Number.: | MFCD03834888 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCC(C)Oc1c(cccc1OC)/C=C(\C#N)/C(=O)Nc2cccc(c2)OC |
InChi: | InChI=1S/C22H24N2O4/c1-5-15(2)28-21-16(8-6-11-20(21)27-4)12-17(14-23)22(25)24-18-9-7-10-19(13-18)26-3/h6-13,15H,5H2,1-4H3,(H,24,25)/b17-12+ |
InChiKey: | InChIKey=LIOBICBGSPMGKS-SFQUDFHCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.