* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034083 |
| English Synonyms: | SYNTHON-LAB SL034083 |
| MDL Number.: | MFCD03834930 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COc1ccc(cc1)/N=C\2/N(C(=O)/C(=C\c3ccc(c(c3)OC)OC)/S2)CCc4c[nH]c5c4cccc5 |
| InChi: | InChI=1S/C29H27N3O4S/c1-34-22-11-9-21(10-12-22)31-29-32(15-14-20-18-30-24-7-5-4-6-23(20)24)28(33)27(37-29)17-19-8-13-25(35-2)26(16-19)36-3/h4-13,16-18,30H,14-15H2,1-3H3/b27-17+,31-29- |
| InChiKey: | InChIKey=KEMJCSRTVSCGTN-CACIESLVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.