* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL033938 |
| English Synonyms: | SYNTHON-LAB SL033938 |
| MDL Number.: | MFCD03834936 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | COCCN\1C(=O)/C(=C\c2cc(c(c(c2)OC)OCC(=O)OC)CC=C)/S/C1=N\c3ccccc3 |
| InChi: | InChI=1S/C26H28N2O6S/c1-5-9-19-14-18(15-21(32-3)24(19)34-17-23(29)33-4)16-22-25(30)28(12-13-31-2)26(35-22)27-20-10-7-6-8-11-20/h5-8,10-11,14-16H,1,9,12-13,17H2,2-4H3/b22-16+,27-26- |
| InChiKey: | InChIKey=WBHKQCMJOZWIBK-RUEDEKBQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.