* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL033934 |
| English Synonyms: | SYNTHON-LAB SL033934 |
| MDL Number.: | MFCD03834940 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | COCCN\1C(=O)/C(=C\c2ccc(cc2)OCc3ccccc3C#N)/S/C1=N\c4ccccc4 |
| InChi: | InChI=1S/C27H23N3O3S/c1-32-16-15-30-26(31)25(34-27(30)29-23-9-3-2-4-10-23)17-20-11-13-24(14-12-20)33-19-22-8-6-5-7-21(22)18-28/h2-14,17H,15-16,19H2,1H3/b25-17+,29-27- |
| InChiKey: | InChIKey=GBZZXGMZFOZNIA-XJBRANNNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.