* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL069194 |
| English Synonyms: | SYNTHON-LAB SL069194 |
| MDL Number.: | MFCD03838527 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | CC(=O)N1c2ccccc2-c3c(nc(nn3)SCc4ccccc4Cl)OC1c5cccc(c5)OC6CCCC6 |
| InChi: | InChI=1S/C30H27ClN4O3S/c1-19(36)35-26-16-7-5-14-24(26)27-28(32-30(34-33-27)39-18-21-9-2-6-15-25(21)31)38-29(35)20-10-8-13-23(17-20)37-22-11-3-4-12-22/h2,5-10,13-17,22,29H,3-4,11-12,18H2,1H3 |
| InChiKey: | InChIKey=SDYDPGKFPIVRMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.