* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053668 |
| English Synonyms: | SYNTHON-LAB SL053668 |
| MDL Number.: | MFCD03838697 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | C=CCOc1ccc(cc1)NC(=O)C(=O)NCCCn2ccnc2 |
| InChi: | InChI=1S/C17H20N4O3/c1-2-12-24-15-6-4-14(5-7-15)20-17(23)16(22)19-8-3-10-21-11-9-18-13-21/h2,4-7,9,11,13H,1,3,8,10,12H2,(H,19,22)(H,20,23) |
| InChiKey: | InChIKey=SVYCCVDCAYSGGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.