* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DAIDZEIN 7,4'-DI-O-GLUCOSIDE |
English Synonyms: | DAIDZEIN 7,4'-DI-O-GLUCOSIDE |
MDL Number.: | MFCD03840486 |
H bond acceptor: | 14 |
H bond donor: | 8 |
Smile: | c1cc(ccc1c2coc3cc(ccc3c2=O)OC4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O |
InChi: | InChI=1S/C27H30O14/c28-8-17-20(31)22(33)24(35)26(40-17)38-12-3-1-11(2-4-12)15-10-37-16-7-13(5-6-14(16)19(15)30)39-27-25(36)23(34)21(32)18(9-29)41-27/h1-7,10,17-18,20-29,31-36H,8-9H2/t17-,18-,20-,21-,22+,23+,24-,25-,26?,27?/m1/s1 |
InChiKey: | InChIKey=VWEWSCDQMVNOJP-DTICSNQNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.