* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(1,3-DIOXAN-2-YL)-4'-PHENOXYPROPIOPHENONE |
CAS: | 884504-36-3 |
English Synonyms: | 3-(1,3-DIOXAN-2-YL)-4'-PHENOXYPROPIOPHENONE |
MDL Number.: | MFCD03844301 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)Oc2ccc(cc2)C(=O)CCC3OCCCO3 |
InChi: | InChI=1S/C19H20O4/c20-18(11-12-19-21-13-4-14-22-19)15-7-9-17(10-8-15)23-16-5-2-1-3-6-16/h1-3,5-10,19H,4,11-14H2 |
InChiKey: | InChIKey=MXYMZXRKNVAAJC-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.