* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,6,7,8-TETRAHYDRO[1,2,4]TRIAZOLO[5,1-B][1,3]BENZOTHIAZOLE |
CAS: | 866134-14-7 |
English Synonyms: | 5,6,7,8-TETRAHYDRO[1,2,4]TRIAZOLO[5,1-B][1,3]BENZOTHIAZOLE |
MDL Number.: | MFCD03848701 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1nc2n(n1)c3c(s2)CCCC3 |
InChi: | InChI=1S/C8H9N3S/c1-2-4-7-6(3-1)11-8(12-7)9-5-10-11/h5H,1-4H2 |
InChiKey: | InChIKey=GKYNUESSPLBUJZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.