* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL036968 |
English Synonyms: | SYNTHON-LAB SL036968 |
MDL Number.: | MFCD03848940 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COc1cc(c(cc1OCC(=O)O)Br)/C=N/NC(=O)c2cccc(c2)C(F)(F)F |
InChi: | InChI=1S/C18H14BrF3N2O5/c1-28-14-6-11(13(19)7-15(14)29-9-16(25)26)8-23-24-17(27)10-3-2-4-12(5-10)18(20,21)22/h2-8H,9H2,1H3,(H,24,27)(H,25,26)/b23-8+ |
InChiKey: | InChIKey=PCJUFCDAVGTRQY-LIMNOBDPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.