* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL037053 |
English Synonyms: | SYNTHON-LAB SL037053 |
MDL Number.: | MFCD03848981 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)ccc(c2/C=N/NC(=O)c3ccc(cc3F)C#N)OCc4ccc(cc4Cl)Cl |
InChi: | InChI=1S/C26H16Cl2FN3O2/c27-19-8-6-18(23(28)12-19)15-34-25-10-7-17-3-1-2-4-20(17)22(25)14-31-32-26(33)21-9-5-16(13-30)11-24(21)29/h1-12,14H,15H2,(H,32,33)/b31-14+ |
InChiKey: | InChIKey=GUSWUKUWTFIEDC-XAZZYMPDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.