* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033472 |
English Synonyms: | SYNTHON-LAB SL033472 |
MDL Number.: | MFCD03848993 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | Cc1cc(c(n1c2ccc(cc2)S(=O)(=O)N)C)/C=C\3/C(=O)N(C(=O)S3)C |
InChi: | InChI=1S/C17H17N3O4S2/c1-10-8-12(9-15-16(21)19(3)17(22)25-15)11(2)20(10)13-4-6-14(7-5-13)26(18,23)24/h4-9H,1-3H3,(H2,18,23,24)/b15-9- |
InChiKey: | InChIKey=RAAOHVCJUOJABF-DHDCSXOGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.