* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037233 |
| English Synonyms: | SYNTHON-LAB SL037233 |
| MDL Number.: | MFCD03848996 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCN1C(=O)C(=Cc2ccc(cc2)OCC(=O)N)C(=O)N(C1=S)CC |
| InChi: | InChI=1S/C17H19N3O4S/c1-3-19-15(22)13(16(23)20(4-2)17(19)25)9-11-5-7-12(8-6-11)24-10-14(18)21/h5-9H,3-4,10H2,1-2H3,(H2,18,21) |
| InChiKey: | InChIKey=PZSFZLIVGMMCLC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.