* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL-2-(2-METHYLBENZOYL)-1,2,3,4-TETRAHYDRO-11H-DIPYRIDO[1,2-A:4',3'-D]PYRIMIDIN-11-ONE |
English Synonyms: | 9-METHYL-2-(2-METHYLBENZOYL)-1,2,3,4-TETRAHYDRO-11H-DIPYRIDO[1,2-A:4',3'-D]PYRIMIDIN-11-ONE |
MDL Number.: | MFCD03849748 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccccc1C(=O)N2CCc3c(c(=O)n4c(cccc4n3)C)C2 |
InChi: | InChI=1S/C20H19N3O2/c1-13-6-3-4-8-15(13)19(24)22-11-10-17-16(12-22)20(25)23-14(2)7-5-9-18(23)21-17/h3-9H,10-12H2,1-2H3 |
InChiKey: | InChIKey=UZBXLGHECVKYJK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.