* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TOSLAB 870666 |
English Synonyms: | TOSLAB 870666 |
MDL Number.: | MFCD03854578 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1ccc(cc1)NC(=O)CC2C(=O)N(C(=O)N2Cc3ccc(cc3)Cl)c4ccc(cc4)Cl |
InChi: | InChI=1S/C27H23Cl2N3O5/c1-2-37-26(35)18-5-11-21(12-6-18)30-24(33)15-23-25(34)32(22-13-9-20(29)10-14-22)27(36)31(23)16-17-3-7-19(28)8-4-17/h3-14,23H,2,15-16H2,1H3,(H,30,33) |
InChiKey: | InChIKey=XFXROAQGKDJKQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.