Molecular Structure:
CCD No.:CCD00428366
BUTTPARK 106\40-69
Formula:C9 H5 N3 O2 S
MolWeight:219.223
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 106\40-69 |
| English Synonyms： | BUTTPARK 106\40-69 |
| MDL Number.： | MFCD03861223 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)n3c(=O)c(=O)[nH]nc3s2 |
| InChi： | InChI=1S/C9H5N3O2S/c13-7-8(14)12-5-3-1-2-4-6(5)15-9(12)11-10-7/h1-4H,(H,10,13) |
| InChiKey： | InChIKey=GWOWLRPLMWPCNW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
