* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL037713 |
| English Synonyms: | SYNTHON-LAB SL037713 |
| MDL Number.: | MFCD03861813 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)CN2C(=O)/C(=C\c3c[nH]c4c3cccc4)/NC2=O)F |
| InChi: | InChI=1S/C19H14FN3O2/c20-15-7-3-1-5-12(15)11-23-18(24)17(22-19(23)25)9-13-10-21-16-8-4-2-6-14(13)16/h1-10,21H,11H2,(H,22,25)/b17-9+ |
| InChiKey: | InChIKey=LKEBYYIMIKDDMS-RQZCQDPDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.