* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL081049 |
| English Synonyms: | SYNTHON-LAB SL081049 |
| MDL Number.: | MFCD03864885 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CCOc1cc(ccc1OCc2cccc3c2cccc3)C(c4c(n[nH]c4O)C)c5c(n[nH]c5O)C |
| InChi: | InChI=1S/C28H28N4O4/c1-4-35-23-14-19(26(24-16(2)29-31-27(24)33)25-17(3)30-32-28(25)34)12-13-22(23)36-15-20-10-7-9-18-8-5-6-11-21(18)20/h5-14,26H,4,15H2,1-3H3,(H2,29,31,33)(H2,30,32,34) |
| InChiKey: | InChIKey=PWLBDSVINDQDQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.