Molecular Structure:
CCD No.:CCD00429021
BUTTPARK 104\40-38
Formula:C21 H14 N4 O4
MolWeight:386.366
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 104\40-38 |
| English Synonyms： | BUTTPARK 104\40-38 |
| MDL Number.： | MFCD03866056 |
| H bond acceptor： | 8 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1)c2cc(c3c4c(c(=O)n(cn4)NC=O)oc3n2)c5ccco5 |
| InChi： | InChI=1S/C21H14N4O4/c1-12-4-6-13(7-5-12)15-9-14(16-3-2-8-28-16)17-18-19(29-20(17)24-15)21(27)25(10-22-18)23-11-26/h2-11H,1H3,(H,23,26) |
| InChiKey： | InChIKey=AHBIIDPJCHOMDG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
