Molecular Structure:
CCD No.:CCD00429032
BUTTPARK 104\40-72
Formula:C27 H19 N3 O2
MolWeight:417.466
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 104\40-72 |
| English Synonyms： | BUTTPARK 104\40-72 |
| MDL Number.： | MFCD03866067 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | c1ccc(cc1)C(=O)COc2c(c(c3c(n2)-c4ccccc4CC3)c5ccncc5)C#N |
| InChi： | InChI=1S/C27H19N3O2/c28-16-23-25(20-12-14-29-15-13-20)22-11-10-18-6-4-5-9-21(18)26(22)30-27(23)32-17-24(31)19-7-2-1-3-8-19/h1-9,12-15H,10-11,17H2 |
| InChiKey： | InChIKey=CPCQMWKPTDRBPJ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
