Molecular Structure:
CCD No.:CCD00429149
BUTTPARK 106\40-91
Formula:C15 H18 N4 O3 S2
MolWeight:366.464
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 106\40-91 |
| English Synonyms： | BUTTPARK 106\40-91 |
| MDL Number.： | MFCD03866190 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | CCOC(=O)N1CCc2c(sc3c2c(=O)n(c(n3)SCC=C)N)C1 |
| InChi： | InChI=1S/C15H18N4O3S2/c1-3-7-23-14-17-12-11(13(20)19(14)16)9-5-6-18(8-10(9)24-12)15(21)22-4-2/h3H,1,4-8,16H2,2H3 |
| InChiKey： | InChIKey=UQVLBFGKBAXGCH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
