Molecular Structure:
CCD No.:CCD00429154
BUTTPARK 107\40-02
Formula:C17 H20 N4 S2
MolWeight:344.505
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | BUTTPARK 107\40-02 |
| English Synonyms： | BUTTPARK 107\40-02 |
| MDL Number.： | MFCD03866195 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCn1c(nnc1SC(C)C)c2cc(sc2N)c3ccccc3 |
| InChi： | InChI=1S/C17H20N4S2/c1-4-21-16(19-20-17(21)22-11(2)3)13-10-14(23-15(13)18)12-8-6-5-7-9-12/h5-11H,4,18H2,1-3H3 |
| InChiKey： | InChIKey=YNZLMCFNWQOIMK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
