* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035562 |
English Synonyms: | SYNTHON-LAB SL035562 |
MDL Number.: | MFCD03923158 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cccc(c1)N2C(=O)/C(=C\c3cccn3C(C)(C)C)/C(=O)NC2=O |
InChi: | InChI=1S/C20H21N3O3/c1-13-7-5-8-15(11-13)23-18(25)16(17(24)21-19(23)26)12-14-9-6-10-22(14)20(2,3)4/h5-12H,1-4H3,(H,21,24,26)/b16-12- |
InChiKey: | InChIKey=YANSUBMIEBJALF-VBKFSLOCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.