* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035642 |
English Synonyms: | SYNTHON-LAB SL035642 |
MDL Number.: | MFCD03923229 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(cnc1)/N=C/c2ccc(cc2)OCC(=O)N |
InChi: | InChI=1S/C14H13N3O2/c15-14(18)10-19-13-5-3-11(4-6-13)8-17-12-2-1-7-16-9-12/h1-9H,10H2,(H2,15,18)/b17-8+ |
InChiKey: | InChIKey=KKVVURKGJLLOII-CAOOACKPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.