* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036124 |
| English Synonyms: | SYNTHON-LAB SL036124 |
| MDL Number.: | MFCD03923567 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1c(cccc1Cl)NC(=O)/C(=C/c2ccc(c(c2)OC)OCc3cccc(c3)C(=O)O)/C#N |
| InChi: | InChI=1S/C26H21ClN2O5/c1-16-21(27)7-4-8-22(16)29-25(30)20(14-28)11-17-9-10-23(24(13-17)33-2)34-15-18-5-3-6-19(12-18)26(31)32/h3-13H,15H2,1-2H3,(H,29,30)(H,31,32)/b20-11+ |
| InChiKey: | InChIKey=IONBYZCKIIXGRL-RGVLZGJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.