* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,9-DIBROMOBICYCLO(6.1.0)NON-2-ENE |
English Synonyms: | 9,9-DIBROMOBICYCLO(6.1.0)NON-2-ENE |
MDL Number.: | MFCD03931222 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1CCC2C(C2(Br)Br)/C=C\C1 |
InChi: | InChI=1S/C9H12Br2/c10-9(11)7-5-3-1-2-4-6-8(7)9/h3,5,7-8H,1-2,4,6H2/b5-3- |
InChiKey: | InChIKey=SNDYDXJCUVOMRX-HYXAFXHYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.