* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | THIAZOLO[5,4-D]THIAZOLE |
CAS: | 251-56-9 |
English Synonyms: | (1,3)THIAZOLO(5,4-D)(1,3)THIAZOLE ; THIAZOLO[5,4-D]THIAZOLE |
MDL Number.: | MFCD03931727 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1nc2c(s1)ncs2 |
InChi: | InChI=1S/C4H2N2S2/c1-5-3-4(7-1)6-2-8-3/h1-2H |
InChiKey: | InChIKey=POQXSXLBPPFJFO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.