* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,3-DIMETHYL-4-NITROSOPHENOL |
| CAS: | 74783-54-3 |
| English Synonyms: | 2,3-DIMETHYL-4-NITROSOPHENOL |
| MDL Number.: | MFCD03931841 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1c(c(ccc1N=O)O)C |
| InChi: | InChI=1S/C8H9NO2/c1-5-6(2)8(10)4-3-7(5)9-11/h3-4,10H,1-2H3 |
| InChiKey: | InChIKey=MHURFZVFYYDDNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.