* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-(1,3-BENZODIOXOL-5-YL)-3-[4-(SEC-BUTYL)ANILINO]-1-PROPANONE |
CAS: | 882748-28-9 |
English Synonyms: | 1-(1,3-BENZODIOXOL-5-YL)-3-[4-(SEC-BUTYL)ANILINO]-1-PROPANONE |
MDL Number.: | MFCD03932027 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCC(C)c1ccc(cc1)NCCC(=O)c2ccc3c(c2)OCO3 |
InChi: | InChI=1S/C20H23NO3/c1-3-14(2)15-4-7-17(8-5-15)21-11-10-18(22)16-6-9-19-20(12-16)24-13-23-19/h4-9,12,14,21H,3,10-11,13H2,1-2H3 |
InChiKey: | InChIKey=XMJNBNWOYODSSI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.