* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB023967 |
| English Synonyms: | VITAS-BB TBB023967 |
| MDL Number.: | MFCD03944538 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC1=CC(OCC(=O)N2CCCC3=CC=CC=C23)=C(Cl)C=C1 |
| InChi: | InChI=1S/C18H18ClNO2/c1-13-8-9-15(19)17(11-13)22-12-18(21)20-10-4-6-14-5-2-3-7-16(14)20/h2-3,5,7-9,11H,4,6,10,12H2,1H3 |
| InChiKey: | InChIKey=NDQVGLULSAJXNZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.