* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL034114 |
English Synonyms: | SYNTHON-LAB SL034114 |
MDL Number.: | MFCD03965946 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COc1cc(ccc1OCc2cccc(c2)C(=O)O)/C=C/3\C(=O)N/C(=N/c4ccccc4)/S3 |
InChi: | InChI=1S/C25H20N2O5S/c1-31-21-13-16(10-11-20(21)32-15-17-6-5-7-18(12-17)24(29)30)14-22-23(28)27-25(33-22)26-19-8-3-2-4-9-19/h2-14H,15H2,1H3,(H,29,30)(H,26,27,28)/b22-14+ |
InChiKey: | InChIKey=MGWJMTARNZAPFS-HYARGMPZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.