* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL052478 |
English Synonyms: | SYNTHON-LAB SL052478 |
MDL Number.: | MFCD03992466 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCc1ccc(cc1)CNC(=O)C(=O)NC |
InChi: | InChI=1S/C12H16N2O2/c1-3-9-4-6-10(7-5-9)8-14-12(16)11(15)13-2/h4-7H,3,8H2,1-2H3,(H,13,15)(H,14,16) |
InChiKey: | InChIKey=DKDLEMFCEJUZLO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.