* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL086204 |
English Synonyms: | SYNTHON-LAB SL086204 |
MDL Number.: | MFCD03992621 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CCNC(=O)CSc2nnc(o2)CCCOc3ccc(cc3Cl)Cl |
InChi: | InChI=1S/C21H21Cl2N3O3S/c22-16-8-9-18(17(23)13-16)28-12-4-7-20-25-26-21(29-20)30-14-19(27)24-11-10-15-5-2-1-3-6-15/h1-3,5-6,8-9,13H,4,7,10-12,14H2,(H,24,27) |
InChiKey: | InChIKey=ZYPSTBRMXHLHCP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.