* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL090964 |
English Synonyms: | SYNTHON-LAB SL090964 |
MDL Number.: | MFCD03992639 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | COc1ccc(cc1)Cc2nnc(o2)SCC(=O)NCCc3ccccc3 |
InChi: | InChI=1S/C20H21N3O3S/c1-25-17-9-7-16(8-10-17)13-19-22-23-20(26-19)27-14-18(24)21-12-11-15-5-3-2-4-6-15/h2-10H,11-14H2,1H3,(H,21,24) |
InChiKey: | InChIKey=IMIZTPSYKGYSLQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.