* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035014 |
English Synonyms: | SYNTHON-LAB SL035014 |
MDL Number.: | MFCD03992681 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC(C)N1C(=O)/C(=C\C(=C\c2ccccc2)\C)/SC1=O |
InChi: | InChI=1S/C16H17NO2S/c1-11(2)17-15(18)14(20-16(17)19)10-12(3)9-13-7-5-4-6-8-13/h4-11H,1-3H3/b12-9+,14-10+ |
InChiKey: | InChIKey=KGKMKERKANABIT-USTLKGCXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.