* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL049869 |
English Synonyms: | SYNTHON-LAB SL049869 |
MDL Number.: | MFCD03992903 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1cccc(c1)CNC(=O)C(=O)Nc2cccc(c2)C(F)(F)F |
InChi: | InChI=1S/C17H15F3N2O3/c1-25-14-7-2-4-11(8-14)10-21-15(23)16(24)22-13-6-3-5-12(9-13)17(18,19)20/h2-9H,10H2,1H3,(H,21,23)(H,22,24) |
InChiKey: | InChIKey=VNTZAMZXSFJBCV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.